Methyl 3-broMo-1H-pyrrolo[2,3-b]pyridine-5-carboxylate - Names and Identifiers
Name | 3-Bromo-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid methyl est
|
Synonyms | Methyl 3-bromo-7-azaindole-5-carboxylate 3-BroMo-7-azaindole-5-carboxylic acid Methyl ester 3-BroMo-7-aza-1H-indol-5-carboxylic acid Methyl ester methyl 3-bromo-1H-pyrrolo[2,3-b]pyridine-5-carboxylate Methyl 3-broMo-1H-pyrrolo[2,3-b]pyridine-5-carboxylate 3-Bromo-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid methyl est 3-Bromo-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid methyl e... 3-Bromo-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid methyl ester 1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid, 3-broMo-, Methyl ester
|
CAS | 1190322-65-6
|
EINECS | 200-258-5 |
InChI | InChI=1S/C9H7BrN2O2/c1-14-9(13)5-2-6-7(10)4-12-8(6)11-3-5/h2-4H,1H3,(H,11,12) |
Methyl 3-broMo-1H-pyrrolo[2,3-b]pyridine-5-carboxylate - Physico-chemical Properties
Molecular Formula | C9H7BrN2O2
|
Molar Mass | 255.07 |
Density | 1.709 |
Storage Condition | 2-8℃ |
Sensitive | Irritant |
MDL | MFCD12962903 |
Methyl 3-broMo-1H-pyrrolo[2,3-b]pyridine-5-carboxylate - Introduction
Methyl 3-bromo-1H-pyrrolo [2,3-b] pyridine-5-carboxylate is an organic compound with the chemical formula C11H6BrNO2. Its properties are as follows:
1. Appearance: 3-bromo-1H-pyrrolo [2,3-b] pyridine-5-carboxylic acid methyl ester is white or light yellow crystal or powder.
2. Melting point: Its melting point is in the range of 126-130°C.
3. Solubility: 3-bromo-1H-pyrrolo [2,3-b] pyridine-5-carboxylic acid methyl ester has good solubility in most organic solvents.
3-bromo-1H-pyrrolo [2,3-b] pyridine-5-carboxylic acid methyl ester is mainly used as follows:
1. chemical synthesis: it is often used as a raw material or intermediate in organic synthesis, and can be used to synthesize pyrrolo [2,3-b] pyridine compounds.
2. Drug research: The compound has certain applications in the field of drug research and can be used to synthesize certain biologically active molecules.
Preparation method: 3-bromo-1H-pyrrolo [2,3-b] pyridine-5-carboxylic acid methyl ester has many preparation methods, and a common method is synthesis by pyridine heterocyclic method. The specific steps include using pyridine and bromoacetate to react under appropriate conditions to generate 3-bromo-1H-pyrrolo [2,3-b] pyridin -5-ol, and then through esterification to obtain the final product.
Safety information: For the safety information of 3-bromo-1H-pyrrolo [2,3-b] pyridine-5-carboxylic acid methyl ester, because there is no specific experimental data, detailed information cannot be provided. However, as an organic compound, it should generally comply with laboratory safety practices, avoid direct contact, ingestion or inhalation of the substance, and ensure that it is handled in a well-ventilated environment. When using the compound, attention should be paid to personal protection, such as wearing laboratory gloves, safety glasses and protective clothing. In case of any accident, medical help should be sought immediately.
Last Update:2024-04-09 20:45:29